| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:58 UTC |
|---|
| Update Date | 2025-03-25 00:47:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160123 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H33N3O22P2 |
|---|
| Molecular Mass | 741.1031 |
|---|
| SMILES | Nc1ccn(C2OC(COP(=O)(O)OP(=O)(O)OC3OC(CO)C(O)C(O)C3OC3OC(C(=O)O)C(O)C(O)C3O)C(O)C2O)c(=O)n1 |
|---|
| InChI Key | ANXSTWODCYWYDD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsamino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesmonocarboxylic acids and derivativeso-glucuronidesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary alcoholsprimary aminespyran carboxylic acidspyrimidine ribonucleoside diphosphatespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | carboxylic acidamino acid or derivativeso-glucuronidemonosaccharidepentose-5-phosphatepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidacetalorganonitrogen compoundoxaneorganoheterocyclic compoundalcoholazacycleheteroaromatic compoundorganic pyrophosphatepyrimidine ribonucleoside diphosphatemonoalkyl phosphatehydrocarbon derivativeprimary amineaminecarbonyl groupglucuronic acid or derivativesaromatic heteromonocyclic compoundpentose phosphateamino acidpyrimidonecarboxylic acid derivativepyrimidineorganic oxideorganopnictogen compoundprimary alcoholimidolactamcarbonic acid derivativepyran carboxylic acid or derivativestetrahydrofuranhydroxy acidoxacyclemonocarboxylic acid or derivativesphosphoric acid esterpyransecondary alcoholorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|