| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:41:59 UTC |
|---|
| Update Date | 2025-03-25 00:47:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160143 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N3O9P |
|---|
| Molecular Mass | 353.0624 |
|---|
| SMILES | Nc1ccn(C2OC(COP(=O)(O)O)OC2C(O)CO)c(=O)n1 |
|---|
| InChI Key | XYATXXICIDKCAI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | nucleoside and nucleotide analogues |
|---|
| Direct Parent | nucleoside and nucleotide analogues |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,3-dioxolanesacetalsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidonessecondary alcohols |
|---|
| Substituents | meta-dioxolanearomatic heteromonocyclic compoundpyrimidonepyrimidineorganic oxideacetalorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compound1,2-diolalcoholcarbonic acid derivativeazacycleheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
