| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:00 UTC |
|---|
| Update Date | 2025-03-25 00:47:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160193 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N3O6S |
|---|
| Molecular Mass | 289.0369 |
|---|
| SMILES | Nc1ccn(C2C=CC(COS(=O)(=O)O)O2)c(=O)n1 |
|---|
| InChI Key | DPTYWMMNDIKOJG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | nucleoside and nucleotide analogues |
|---|
| Direct Parent | nucleoside and nucleotide analogues |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesazacyclic compoundsdihydrofuransheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidonessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesteraromatic heteromonocyclic compoundpyrimidonepyrimidineorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compounddihydrofurancarbonic acid derivativeorganic sulfuric acid or derivativesazacycleheteroaromatic compoundoxacycleorganic oxygen compoundsulfate-esterhydrocarbon derivativeprimary amineorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
|---|
