| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:02 UTC |
|---|
| Update Date | 2025-03-25 00:47:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160250 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13N7 |
|---|
| Molecular Mass | 243.1232 |
|---|
| SMILES | Nc1nc(N)c2c(n1)NCC(c1cccnc1)N2 |
|---|
| InChI Key | DKHWYIFGHKBJSA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | secondary alkylarylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyridines and derivativespyrimidines and pyrimidine derivatives |
|---|
| Substituents | azacycleheteroaromatic compoundsecondary aliphatic/aromatic aminepyrimidinepyridinearomatic heteropolycyclic compoundorganopnictogen compoundhydrocarbon derivativeprimary amineimidolactamorganoheterocyclic compound |
|---|
