| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:02 UTC |
|---|
| Update Date | 2025-03-25 00:47:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160261 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N5O3S |
|---|
| Molecular Mass | 271.0739 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)=NCC(C(O)C(O)CS)N=2 |
|---|
| InChI Key | RNRZXLUQKYWKDV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkylthiolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganopnictogen compoundsorganosulfur compoundsprimary aminespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | pyrimidoneorganosulfur compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactam1,2-diolalcoholvinylogous amidepterinazacycleheteroaromatic compoundorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundaminealkylthiolorganooxygen compound |
|---|
