Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:42:04 UTC |
---|
Update Date | 2025-03-25 00:47:14 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02160322 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C16H16N2O4 |
---|
Molecular Mass | 300.111 |
---|
SMILES | Nc1c(O)cccc1C(=O)CCNC(=O)c1ccccc1O |
---|
InChI Key | CSOXFXZHFDEKQP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbonyl compounds |
---|
Direct Parent | alkyl-phenylketones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsamino acids and derivativesaryl alkyl ketonesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminessalicylamidessecondary carboxylic acid amidesvinylogous acidsvinylogous amides |
---|
Substituents | monocyclic benzene moietyaryl alkyl ketoneamino acid or derivativesbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amidebenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidcarboxamide groupsalicylamidearomatic homomonocyclic compoundsecondary carboxylic acid amidevinylogous acidsalicylic acid or derivativesphenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketone |
---|