| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:04 UTC |
|---|
| Update Date | 2025-03-25 00:47:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160341 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11NO4S |
|---|
| Molecular Mass | 265.0409 |
|---|
| SMILES | NS(=O)(=O)Oc1ccccc1Oc1ccccc1 |
|---|
| InChI Key | BSYLYYRTCGUGEC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | diarylethershydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivativesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol etheretherorganic sulfuric acid or derivativesaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compounddiphenyletherorganooxygen compound |
|---|
