| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:07 UTC |
|---|
| Update Date | 2025-03-25 00:47:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160457 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6ClNO4 |
|---|
| Molecular Mass | 202.9985 |
|---|
| SMILES | Nc1cc(Cl)c(O)c(C(=O)O)c1O |
|---|
| InChI Key | MAKJFKNMFHBQJF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds3-halobenzoic acidsamino acidsaryl chloridesbenzoic acidsbenzoyl derivativeschlorobenzeneshalobenzoic acidshalophenolshydrocarbon derivativesmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochloridesorganooxygen compoundsorganopnictogen compoundsp-chlorophenolsprimary aminesresorcinolsvinylogous acids |
|---|
| Substituents | carboxylic acidamino acid or derivativesamino acid3-halobenzoic acid or derivativesorganochloridebenzoylsalicylic acidcarboxylic acid derivativeorganohalogen compoundresorcinolorganic oxide3-halobenzoic acid4-halophenolorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidaryl chloride2-chlorophenolchlorobenzenehalobenzoic acid4-chlorophenolhalobenzoic acid or derivativesaryl halidearomatic homomonocyclic compound2-halophenolvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativeprimary amineorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
