| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:11 UTC |
|---|
| Update Date | 2025-03-25 00:47:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160584 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18N6O2S |
|---|
| Molecular Mass | 358.1212 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1NC(CSc2ccccc2)C(O)C1O |
|---|
| InChI Key | FEBVIQBTEUGASS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkylarylthioethersazacyclic compoundsbenzene and substituted derivativesdialkylaminesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesnucleoside and nucleotide analoguesorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativespyrrolidinessecondary alcoholssulfenyl compoundsthiophenol ethersthiophenols |
|---|
| Substituents | monocyclic benzene moietyimidazopyrimidinealkylarylthioetherorganosulfur compoundaryl thioetherpyrimidinethiophenolaromatic heteropolycyclic compoundimidazolethiophenol etherorganonitrogen compoundorganopnictogen compoundpyrrolidineimidolactamorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholsecondary aliphatic aminesulfenyl compoundazacyclepurine nucleosideheteroaromatic compoundsecondary amineorganic oxygen compoundthioethersecondary alcoholhydrocarbon derivativebenzenoidprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
