| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:11 UTC |
|---|
| Update Date | 2025-03-25 00:47:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160588 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N5O11P3 |
|---|
| Molecular Mass | 475.0059 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1CC(OP(=O)(O)OP(=O)(O)O)C(CP(=O)(O)O)O1 |
|---|
| InChI Key | GMXOWTUSPDAKDI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | ribonucleoside 3'-phosphates |
|---|
| Subclass | ribonucleoside 3'-phosphates |
|---|
| Direct Parent | ribonucleoside 3'-phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganic pyrophosphatesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativestetrahydrofurans |
|---|
| Substituents | imidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundimidolactamorganophosphonic acid derivativeorganoheterocyclic compoundazolen-substituted imidazoleribonucleoside 3'-phosphateazacycletetrahydrofuranheteroaromatic compoundorganic pyrophosphateoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
