| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:13 UTC |
|---|
| Update Date | 2025-03-25 00:47:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160644 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N6O4 |
|---|
| Molecular Mass | 282.1077 |
|---|
| SMILES | Nc1ncnc2nc(C(O)C(O)C(O)CO)nc(N)c12 |
|---|
| InChI Key | GEJIFSGSIWROBV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary alcoholsprimary aminessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholazacycleheteroaromatic compoundpyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholimidolactamamineorganooxygen compound |
|---|
