| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:14 UTC |
|---|
| Update Date | 2025-03-25 00:47:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160702 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17N5O8S |
|---|
| Molecular Mass | 403.0798 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(COS(=O)(=O)O)C2OC(CO)C(O)C21 |
|---|
| InChI Key | LDQHQCXGBMKFJN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine 2'-deoxyribonucleosides |
|---|
| Direct Parent | purine 2'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesazacyclic compoundsdialkyl ethersfurofuransheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssulfuric acid monoesterstetrahydrofurans |
|---|
| Substituents | sulfuric acid monoesterethermonosaccharideimidazopyrimidinedialkyl etherpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundfurofuranimidazolealkyl sulfateorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactampurine 2'-deoxyribonucleosideorganoheterocyclic compoundazolen-substituted imidazolealcoholorganic sulfuric acid or derivativesazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
|---|