| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:16 UTC |
|---|
| Update Date | 2025-03-25 00:47:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160768 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12ClN5O4 |
|---|
| Molecular Mass | 301.0578 |
|---|
| SMILES | Nc1nc(O)nc2c1ncn2C1OC(CO)C(Cl)C1O |
|---|
| InChI Key | XGKWWXLFPYWICP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine 3'-deoxyribonucleosides |
|---|
| Direct Parent | purine 3'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl chloridesazacyclic compoundschlorohydrinsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesimidolactamsn-substituted imidazolesorganochloridesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | chlorohydrinalkyl chlorideorganochloridehydroxypyrimidineimidazopyrimidineorganohalogen compoundpyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideprimary alcoholimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranhalohydrinheteroaromatic compoundoxacyclepurine 3'-deoxyribonucleosideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
