| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:17 UTC |
|---|
| Update Date | 2025-03-25 00:47:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160796 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H15N7O |
|---|
| Molecular Mass | 297.1338 |
|---|
| SMILES | Nc1nc2c(N)nc(NCCO)nc2nc1-c1ccccc1 |
|---|
| InChI Key | VIHYCRRXFPGDAR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkanolaminesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrazinespyrimidines and pyrimidine derivativessecondary alkylarylamines |
|---|
| Substituents | alcoholmonocyclic benzene moietyazacycleheteroaromatic compoundsecondary aminepteridinesecondary aliphatic/aromatic aminepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compoundalkanolamine |
|---|
