| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:17 UTC |
|---|
| Update Date | 2025-03-25 00:47:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160818 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12FN3 |
|---|
| Molecular Mass | 265.1015 |
|---|
| SMILES | Nc1ncc(-c2ccccc2)c(-c2ccc(F)cc2)n1 |
|---|
| InChI Key | JWANIGJYDNUWHE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | fluorobenzenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl fluoridesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganofluoridesorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | aryl fluoridearomatic heteromonocyclic compoundazacycleorganofluorideheteroaromatic compoundorganohalogen compoundaryl halidepyrimidinefluorobenzeneorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganoheterocyclic compound |
|---|