| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:18 UTC |
|---|
| Update Date | 2025-03-25 00:47:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160834 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17N5O7 |
|---|
| Molecular Mass | 355.1128 |
|---|
| SMILES | Nc1nc2ncc(COC3(CO)OC(CO)C(O)C3O)nc2c(=O)[nH]1 |
|---|
| InChI Key | OMNYFSMVUHGMMG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesketalslactamsmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrazinespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | lactammonosaccharidepyrimidonepyrimidinesaccharideorganic oxideacetalaromatic heteropolycyclic compoundketalorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholpterinazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
