| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:18 UTC |
|---|
| Update Date | 2025-03-25 00:47:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160850 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H13FN4O2 |
|---|
| Molecular Mass | 324.1023 |
|---|
| SMILES | Nc1ncnc(-c2ccc(F)cc2)c1C(=O)Nc1ccc(O)cc1 |
|---|
| InChI Key | SPZXBYBACWRZEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | aromatic anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamino acids and derivativesaryl fluoridesazacyclic compoundscarboxylic acids and derivativesfluorobenzenesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganofluoridesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrimidinecarboxylic acids and derivativessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | aryl fluoridearomatic heteromonocyclic compoundamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganohalogen compoundpyrimidinearomatic anilidefluorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundvinylogous amideazacycleorganofluorideheteroaromatic compoundpyrimidine-5-carboxylic acid or derivativescarboxamide grouparyl halidesecondary carboxylic acid amideorganic oxygen compoundphenolhydrocarbon derivativeprimary amineorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
