| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:18 UTC |
|---|
| Update Date | 2025-03-25 00:47:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160857 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N5O4 |
|---|
| Molecular Mass | 295.1281 |
|---|
| SMILES | Nc1ncnc2c(CNC3C(O)C(O)C(O)C3O)c[nH]c12 |
|---|
| InChI Key | VXBXGVHEAVVVLC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolopyrimidines |
|---|
| Subclass | pyrrolopyrimidines |
|---|
| Direct Parent | pyrrolopyrimidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclitols and derivativescyclopentanolsdialkylaminesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivativespyrroles |
|---|
| Substituents | alcoholsecondary aliphatic amineazacycleheteroaromatic compoundcyclitol or derivativescyclic alcoholsecondary aminecyclopentanolpyrimidinepyrrolopyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|
