| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:20 UTC |
|---|
| Update Date | 2025-03-25 00:47:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160903 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H13N6O7P |
|---|
| Molecular Mass | 384.0583 |
|---|
| SMILES | Nc1nc2nc3c(ccn3CC(O)C(=O)COP(=O)(O)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | FSRPOJGTZPRLKO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesazacyclic compoundsglycerone phosphatesheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonespyrrolopyrazinessecondary alcoholssubstituted pyrroles |
|---|
| Substituents | carbonyl grouplactammonosaccharidepyrimidonesubstituted pyrrolealpha-hydroxy ketonepyrimidineketonesaccharideorganic oxideglycerone or derivativesaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolopyrazinealcoholpterinazacycleheteroaromatic compoundglycerone phosphateorganic oxygen compoundphosphoric acid esterpyrazinemonoalkyl phosphateacyloinpyrrolesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
