| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:20 UTC |
|---|
| Update Date | 2025-03-25 00:47:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160912 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7F4N5O3 |
|---|
| Molecular Mass | 309.0485 |
|---|
| SMILES | Nc1nc2ncc(C(O)C(F)(F)C(O)(F)F)nc2c(=O)[nH]1 |
|---|
| InChI Key | PMQNLNHVKWGMCZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaromatic alcoholsazacyclic compoundsfluorohydrinsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganofluoridesorganopnictogen compoundsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | aromatic alcohollactampyrimidonefluorohydrinorganohalogen compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkyl halidealcoholpterinazacyclehalohydrinalkyl fluorideorganofluorideheteroaromatic compoundorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
