| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:20 UTC |
|---|
| Update Date | 2025-03-25 00:47:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160927 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16FN5O5 |
|---|
| Molecular Mass | 377.1135 |
|---|
| SMILES | Nc1nc2nc(-c3ccc(F)cc3)n(C3OC(CO)C(O)C3O)c2c(=O)[nH]1 |
|---|
| InChI Key | CVYSHMVIYPHXJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl fluoridesazacyclic compoundsfluorobenzenesheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesnucleoside and nucleotide analoguesorganic oxidesorganofluoridesorganopnictogen compoundsoxacyclic compoundsphenylimidazolesprimary alcoholsprimary aminespurines and purine derivativespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | aryl fluoridemonocyclic benzene moietylactammonosaccharidepyrimidoneimidazopyrimidineorganohalogen compoundpyrimidinefluorobenzenesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideorganofluorideheteroaromatic compoundaryl halideoxacycleorganic oxygen compound2-phenylimidazolesecondary alcoholhypoxanthinehydrocarbon derivativebenzenoidprimary aminepurineorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
