| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:22 UTC |
|---|
| Update Date | 2025-03-25 00:47:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160993 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H18NO2S+ |
|---|
| Molecular Mass | 192.1053 |
|---|
| SMILES | C=CCC(CS(=O)O)[N+](C)(C)C |
|---|
| InChI Key | PDVUTNZEYWHHHG-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | sulfinic acids and derivatives |
|---|
| Subclass | sulfinic acids |
|---|
| Direct Parent | sulfinic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkanesulfinic acids and derivativesamineshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsorganosulfur compoundstetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundtetraalkylammonium saltquaternary ammonium saltorganosulfur compoundsulfinic acidalkanesulfinic acid or derivativesorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamine |
|---|
