| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:22 UTC |
|---|
| Update Date | 2025-03-25 00:47:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02160999 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11NO6S |
|---|
| Molecular Mass | 225.0307 |
|---|
| SMILES | NC1=CS(=O)(=O)OC1C(O)C(O)CO |
|---|
| InChI Key | OFSXUGQYURBRLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | sulfonic acid esters |
|---|
| Direct Parent | sulfonic acid esters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acid estersoxacyclic compoundsoxathiolesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholorganosulfonic acid or derivativesorganosulfonic acid estersulfonic acid esteroxacycleorganic oxideorganic oxygen compound1,2-oxathiolealiphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
