Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:42:23 UTC |
---|
Update Date | 2025-03-25 00:47:20 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02161018 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C19H17NO8 |
---|
Molecular Mass | 387.0954 |
---|
SMILES | NC1C(C(=O)O)OC(Oc2ccc3c(c2)oc(=O)c2ccccc23)C(O)C1O |
---|
InChI Key | NKATUUWTTWTFIH-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | glucuronic acid derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1,2-diols1-benzopyrans2-benzopyransacetalsbeta amino acids and derivativescarbonyl compoundscarboxylic acidscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol etherspyran carboxylic acidspyranones and derivativessecondary alcohols |
---|
Substituents | phenol ethercarbonyl groupcarboxylic acidglucuronic acid or derivatives1-benzopyranmonosaccharidecarboxylic acid derivativepyran carboxylic acidlactoneorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundpyranoneorganopnictogen compoundoxaneorganoheterocyclic compound1,2-diolalcoholbenzopyranpyran carboxylic acid or derivativesheteroaromatic compoundisocoumarinbeta amino acid or derivativescoumarinoxacyclemonocarboxylic acid or derivativespyran2-benzopyransecondary alcoholhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compound |
---|