| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:24 UTC |
|---|
| Update Date | 2025-03-25 00:47:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161073 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13IN2O3 |
|---|
| Molecular Mass | 383.9971 |
|---|
| SMILES | NCC(=O)Nc1ccc(Oc2ccc(O)cc2)c(I)c1 |
|---|
| InChI Key | DAZMHUZBBXVDCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsanilidesaryl iodidescarbonyl compoundscarboxylic acids and derivativesdiarylethershydrocarbon derivativesiodobenzenesmonoalkylaminesn-arylamidesorganic oxidesorganoiodidesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupether1-hydroxy-2-unsubstituted benzenoidn-arylamidealpha-amino acid or derivativescarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundalpha-amino acid amidecarboxamide grouparyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundphenolhydrocarbon derivativeprimary aliphatic aminearyl iodideorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|