| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:27 UTC |
|---|
| Update Date | 2025-03-25 00:47:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161171 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H27N3O5 |
|---|
| Molecular Mass | 353.1951 |
|---|
| SMILES | NC(Cc1ccc(O)c(O)c1)C(=O)N1CCN(CCOCCO)CC1 |
|---|
| InChI Key | VEMXGZNFXHQAQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalcohols and polyolsalpha amino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonoalkylaminesn-alkylpiperazinesorganic oxidesorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoiddialkyl etherorganic oxidepiperazinetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundamphetamine or derivativesalcoholalpha-amino acid amideazacyclen-alkylpiperazinetertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidcarboxamide grouporganic oxygen compound1,4-diazinanephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
