| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:30 UTC |
|---|
| Update Date | 2025-03-25 00:47:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161304 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N5O2S2 |
|---|
| Molecular Mass | 325.0667 |
|---|
| SMILES | NC(N)=Nc1nc(CSCCNC(=O)c2ccco2)cs1 |
|---|
| InChI Key | VLWVABNOGIWGBY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2,4-disubstituted thiazoles2-heteroaryl carboxamidesazacyclic compoundscarboxylic acids and derivativesdialkylthioethersguanidinesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundspropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | aromatic heteromonocyclic compoundguanidineorganosulfur compoundcarboxylic acid derivative2-heteroaryl carboxamidepropargyl-type 1,3-dipolar organic compoundorganic oxideorganonitrogen compoundorganopnictogen compoundazolefuroic acid or derivativessulfenyl compoundazacycledialkylthioetherheteroaromatic compoundorganic 1,3-dipolar compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundthioether2,4-disubstituted 1,3-thiazolehydrocarbon derivativeorganic nitrogen compoundthiazoleorganooxygen compound |
|---|
