| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:31 UTC |
|---|
| Update Date | 2025-03-25 00:47:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161351 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15N7O7 |
|---|
| Molecular Mass | 381.1033 |
|---|
| SMILES | NC(Cn1c2nc(=O)[nH]c(=O)c-2nc2[nH]c(=O)[nH]c(=O)c21)C(O)C(O)CO |
|---|
| InChI Key | KEZBCSULRDNWCE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkylaminesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspyrazinespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | alcoholvinylogous amidecarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidonepteridinepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundprimary alcoholorganooxygen compound |
|---|
