| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:33 UTC |
|---|
| Update Date | 2025-03-25 00:47:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161415 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H24N8O4S |
|---|
| Molecular Mass | 460.1641 |
|---|
| SMILES | NCCSCC(NC(=O)c1ccc(NCC2=Nc3c([nH]c(N)nc3=O)NC2)cc1)C(=O)O |
|---|
| InChI Key | OZFWBVOWZZDUOH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | hippuric acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidscysteine and derivativesdialkylthioethersheteroaromatic compoundshydrocarbon derivativesketiminesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsphenylalkylaminespropargyl-type 1,3-dipolar organic compoundspterins and derivativespyrimidonessecondary alkylarylaminessecondary carboxylic acid amidessulfenyl compoundsvinylogous amides |
|---|
| Substituents | carboxylic acidamino acid or derivativesbenzoylalpha-amino acid or derivativespteridineorganonitrogen compoundalpha-amino acidorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesvinylogous amidepterinsulfenyl compoundazacyclen-acyl-alpha-amino aciddialkylthioetherheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aliphatic/aromatic aminesecondary carboxylic acid amidethioethercysteine or derivativeshydrocarbon derivativeprimary aliphatic amineprimary amineamineketiminecarbonyl groupamino acidiminepyrimidoneorganosulfur compoundcarboxylic acid derivativepyrimidinepropargyl-type 1,3-dipolar organic compoundorganic oxidearomatic heteropolycyclic compoundorganopnictogen compoundhippuric acid or derivativessecondary aminecarboxamide groupmonocarboxylic acid or derivativesorganic oxygen compoundphenylalkylamineorganic nitrogen compoundorganooxygen compound |
|---|