| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:36 UTC |
|---|
| Update Date | 2025-03-25 00:47:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161526 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H4F7NO3S |
|---|
| Molecular Mass | 278.98 |
|---|
| SMILES | NS(=O)(=O)C(F)(F)C(O)C(F)(F)C(F)(F)F |
|---|
| InChI Key | RXQFFUURJBUHGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organic sulfonamides |
|---|
| Direct Parent | organic sulfonamides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaminosulfonyl compoundsfluorohydrinshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganofluoridesorganosulfonamidessecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundorganosulfonic acid or derivativesaminosulfonyl compoundhalohydrinalkyl fluorideorganofluoridefluorohydrinorganosulfur compoundorganohalogen compoundorganosulfonic acid amideorganic oxidesulfonylorganic oxygen compoundsecondary alcoholalkyl halidehydrocarbon derivativeorganic nitrogen compoundorganic sulfonic acid amideorganooxygen compound |
|---|
