| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:42 UTC |
|---|
| Update Date | 2025-03-25 00:47:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161750 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H17ClN2O |
|---|
| Molecular Mass | 288.1029 |
|---|
| SMILES | NCCCC1(c2ccc(Cl)cc2)OCc2cnccc21 |
|---|
| InChI Key | CTALYNSMEIJTLS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundschlorobenzenesdialkyl ethersheteroaromatic compoundshydrocarbon derivativesmonoalkylaminesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspolyhalopyridinespyridines and derivatives |
|---|
| Substituents | etherorganochloridepolyhalopyridineorganohalogen compounddialkyl etherphenylbutylaminearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundaryl chloridechlorobenzeneazacycleheteroaromatic compoundaryl halideoxacyclepyridineorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|