| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:44 UTC |
|---|
| Update Date | 2025-03-25 00:47:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161820 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19O11P |
|---|
| Molecular Mass | 394.0665 |
|---|
| SMILES | O=C(O)C1OC(OP(=O)(O)OCc2ccccc2CO)C(O)C(O)C1O |
|---|
| InChI Key | BWIYVXMSZDGZIU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsbenzyl alcoholsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietycarbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivativepyran carboxylic acidbeta-hydroxy acidorganic oxideoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidbenzyl alcoholoxacycledialkyl phosphatemonocarboxylic acid or derivativesphosphoric acid esterpyransecondary alcoholhydrocarbon derivativebenzenoidorganic phosphoric acid derivativealkyl phosphate |
|---|
