| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:44 UTC |
|---|
| Update Date | 2025-03-25 00:47:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161823 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H12O14S2 |
|---|
| Molecular Mass | 383.9668 |
|---|
| SMILES | O=C(O)C1OC(OS(=O)(=O)O)C(OS(=O)(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | QCMIVRKTWMNBPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxepanes |
|---|
| Subclass | oxepanes |
|---|
| Direct Parent | oxepanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholsulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativeshydroxy acidcarboxylic acid derivativeoxepaneoxacyclebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl sulfatealiphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|
