| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:45 UTC |
|---|
| Update Date | 2025-03-25 00:47:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161837 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12O7S |
|---|
| Molecular Mass | 252.0304 |
|---|
| SMILES | C=CC12OS(=O)(=O)OC1CC(O)C(O)C2O |
|---|
| InChI Key | IXAUGTNZCVIDJX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid diesters |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescyclitols and derivativesdioxathiolaneshydrocarbon derivativesorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholdioxathiolanecyclitol or derivativescyclic alcoholaliphatic heteropolycyclic compoundoxacycleorganic oxideorganic oxygen compoundsulfuric acid diesteralkyl sulfatesecondary alcoholhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
