| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:45 UTC |
|---|
| Update Date | 2025-03-25 00:47:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02161850 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14Cl2O8 |
|---|
| Molecular Mass | 416.0066 |
|---|
| SMILES | O=C(O)C1OC(Oc2cc(Cl)ccc2Oc2ccc(Cl)cc2O)C(O)C1O |
|---|
| InChI Key | ARGLNMHQFZMPNH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsaryl chloridesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidschlorobenzenesdiarylethershalophenolshydrocarbon derivativesm-chlorophenolsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesoxacyclic compoundsphenol ethersphenoxy compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundorganochloride1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativeorganohalogen compoundbeta-hydroxy acidsaccharideorganic oxideacetalorganoheterocyclic compound1,2-diolaryl chloridechlorobenzenealcohol3-halophenol3-chlorophenoltetrahydrofuranhydroxy acid1-hydroxy-4-unsubstituted benzenoidaryl halideoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
