| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:51 UTC |
|---|
| Update Date | 2025-03-25 00:47:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162088 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H26O15 |
|---|
| Molecular Mass | 506.1272 |
|---|
| SMILES | O=C(O)C1OC(OC2(COC3(CO)OC(CO)C(O)C3O)Oc3ccccc3O2)C(O)C(O)C1O |
|---|
| InChI Key | QSZPBDCSEFTVJB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | benzenoidsbenzodioxolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid orthoesterscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesortho estersoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupcarboxylic acidortho estero-glucuronidemonosaccharidecarboxylic acid orthoestercarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundketalorthocarboxylic acid derivativeoxaneprimary alcoholorganoheterocyclic compoundbenzodioxolealcoholpyran carboxylic acid or derivativestetrahydrofuranhydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoid |
|---|
