| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:53 UTC |
|---|
| Update Date | 2025-03-25 00:47:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162166 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO8 |
|---|
| Molecular Mass | 337.0798 |
|---|
| SMILES | O=C(O)C1OC(O)C(O)C(O)C1Oc1ccc2ccc(O)nc2c1 |
|---|
| InChI Key | MHIYXJQFSVBIQL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols2-halopyridinesalkyl aryl ethersazacyclic compoundscarbonyl compoundscarboxylic acidshemiacetalsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol etherspolyhalopyridinespyran carboxylic acidsquinolones and derivativessecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidglucuronic acid or derivativespolyhalopyridinemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundquinolineorganopnictogen compoundhemiacetal2-halopyridineoxaneorganoheterocyclic compound1,2-diolalcoholquinolonepyran carboxylic acid or derivativesazacycleheteroaromatic compoundhydroxypyridineoxacyclemonocarboxylic acid or derivativespyridinepyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|