| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:53 UTC |
|---|
| Update Date | 2025-03-25 00:47:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162179 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11O12P |
|---|
| Molecular Mass | 317.9988 |
|---|
| SMILES | O=C(O)C1OC(O)(C(=O)O)OC(COP(=O)(O)O)C1O |
|---|
| InChI Key | LMBXNFCTJYBLLY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorthocarboxylic acid derivativesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidcarboxylic acid derivativeoxacyclebeta-hydroxy acidorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorthocarboxylic acid derivativeorganic phosphoric acid derivativemeta-dioxanealkyl phosphateorganoheterocyclic compoundorganooxygen compound |
|---|
