Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:42:55 UTC |
---|
Update Date | 2025-03-25 00:47:31 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02162245 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C17H20N2O4 |
---|
Molecular Mass | 316.1423 |
---|
SMILES | O=C(O)CC1NC(=O)C2CCCN2C(=O)C1Cc1ccccc1 |
---|
InChI Key | VTZFYIFISWRJNK-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | peptidomimetics |
---|
Subclass | hybrid peptides |
---|
Direct Parent | hybrid peptides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1,4-diazepanesalpha amino acidsazacyclic compoundsbenzene and substituted derivativesbeta amino acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolidinessecondary carboxylic acid amidestertiary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl grouplactamcarboxylic acid1,4-diazepanediazepanealpha-amino acid or derivativescarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compoundazacyclecarboxamide groupbeta amino acid or derivativessecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhybrid peptidehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
---|