| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:55 UTC |
|---|
| Update Date | 2025-03-25 00:47:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162246 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N3O5 |
|---|
| Molecular Mass | 255.0855 |
|---|
| SMILES | O=C(O)CC1NC(=O)NC(=O)C2CCCN2C1=O |
|---|
| InChI Key | NWYIJOGBOKAQAU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | cyclic peptides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboximidesdipeptideshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesn-acyl ureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolidinestertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidalpha-amino acid or derivativesaliphatic heteropolycyclic compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidepyrrolidineureideorganoheterocyclic compoundn-acyl ureacarbonic acid derivativeazacyclecarboxamide groupalpha-dipeptidemonocarboxylic acid or derivativesorganic oxygen compoundcyclic alpha peptidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
