| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:56 UTC |
|---|
| Update Date | 2025-03-25 00:47:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162294 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14O9S |
|---|
| Molecular Mass | 298.0359 |
|---|
| SMILES | O=C(O)CC1(O)CCC(O)(C(=O)O)CC1S(=O)(=O)O |
|---|
| InChI Key | KOAADZWWGYJLOM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganosulfonic acidssulfonylstertiary alcohols |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupcarboxylic acidalpha-hydroxy acidorganosulfonic acidcyclohexanolhydroxy acidcyclic alcoholorganosulfur compoundcarboxylic acid derivativetertiary alcoholorganic oxidesulfonylorganic sulfonic acid or derivativesaliphatic homomonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivative |
|---|
