Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:42:58 UTC |
---|
Update Date | 2025-03-25 00:47:32 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02162349 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C17H22N2O7 |
---|
Molecular Mass | 366.1427 |
---|
SMILES | O=C(O)CCC(NC(=O)c1ccc(NCC2COCCO2)cc1)C(=O)O |
---|
InChI Key | IKRKUADBALDGCR-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | glutamic acid and derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1,4-dioxanesalpha amino acidsamino acidsbenzoyl derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenylalkylaminessecondary alkylarylaminessecondary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundamino acidbenzoyldialkyl etherbenzamideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesn-acyl-alpha-amino acidhippuric acid or derivativesbenzoic acid or derivativesglutamic acid or derivativessecondary aminecarboxamide groupsecondary aliphatic/aromatic amineoxacyclesecondary carboxylic acid amideorganic oxygen compoundpara-dioxanedicarboxylic acid or derivativesphenylalkylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
---|