| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:42:59 UTC |
|---|
| Update Date | 2025-03-25 00:47:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162404 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15NO6 |
|---|
| Molecular Mass | 257.0899 |
|---|
| SMILES | O=C(O)CCC(C(=O)O)N1C=CCCC1C(=O)O |
|---|
| InChI Key | YFOGHTYSBGRPBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsamino fatty acidsazacyclic compoundscarbonyl compoundscarboxylic acidsenaminesfatty acylshydrocarbon derivativesorganic oxidesorganopnictogen compoundstetrahydropyridinestrialkylaminestricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidamino acidtricarboxylic acid or derivativesorganic oxidealiphatic heteromonocyclic compoundalpha-amino acidorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundazacycletertiary aliphatic aminetetrahydropyridineglutamic acid or derivativesamino fatty acidorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compoundenamine |
|---|
