| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:00 UTC |
|---|
| Update Date | 2025-03-25 00:47:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162424 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H21NO3 |
|---|
| Molecular Mass | 239.1521 |
|---|
| SMILES | C=CC1(O)CN(C(=O)C(C)O)C2CCCCC21 |
|---|
| InChI Key | CQTCXIPZFRDZDL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholstertiary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl groupazacycleindolen-acylpyrrolidinecarboxamide groupcarboxylic acid derivativealiphatic heteropolycyclic compoundtertiary alcoholorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpyrrolidineorganooxygen compound |
|---|
