| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:00 UTC |
|---|
| Update Date | 2025-03-25 00:47:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162434 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O3 |
|---|
| Molecular Mass | 266.0943 |
|---|
| SMILES | O=C(O)CC(=Cc1ccccc1)C(=O)c1ccccc1 |
|---|
| InChI Key | MHDNANJMWQQRRP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | linear 1,3-diarylpropanoids |
|---|
| Direct Parent | linear 1,3-diarylpropanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-branched alpha,beta-unsaturated ketonesaryl ketonesbenzoyl derivativesbutyrophenonescarboxylic acidscinnamic acids and derivativesgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | alpha-branched alpha,beta-unsaturated-ketonelinear 1,3-diarylpropanoidmonocyclic benzene moietycarbonyl groupcarboxylic acidbenzoylalpha,beta-unsaturated ketonecarboxylic acid derivativegamma-keto acidketonebutyrophenonearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundketo acidhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
