| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:05 UTC |
|---|
| Update Date | 2025-03-25 00:47:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162637 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9F3O2 |
|---|
| Molecular Mass | 218.0555 |
|---|
| SMILES | O=C(CO)Cc1ccc(C(F)(F)F)cc1 |
|---|
| InChI Key | WCWKKSOLMDTRAE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | trifluoromethylbenzenes |
|---|
| Direct Parent | trifluoromethylbenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl fluoridesalpha-hydroxy ketoneshydrocarbon derivativesorganic oxidesorganofluorides |
|---|
| Substituents | alcoholcarbonyl groupalkyl fluorideorganofluoridealpha-hydroxy ketoneorganohalogen compoundketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundalkyl halidehydrocarbon derivativetrifluoromethylbenzeneorganooxygen compound |
|---|
