Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:43:06 UTC |
---|
Update Date | 2025-03-25 00:47:34 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02162651 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C14H16N4O2 |
---|
Molecular Mass | 272.1273 |
---|
SMILES | C=CC1=C(C)C(=O)NC1=Cc1[nH]c(N)c(C(N)=O)c1C |
---|
InChI Key | IVACPHSCVXJLAM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyrroles |
---|
Subclass | pyrrole carboxylic acids and derivatives |
---|
Direct Parent | pyrrole carboxamides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundsprimary aminesprimary carboxylic acid amidespyrrolinessecondary carboxylic acid amidesvinylogous amides |
---|
Substituents | primary carboxylic acid amidecarbonyl grouplactamaromatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundpyrrole-3-carboxamideorganopnictogen compoundvinylogous amideazacycleheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundpyrrolinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
---|