| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:06 UTC |
|---|
| Update Date | 2025-03-25 00:47:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162674 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15O10P |
|---|
| Molecular Mass | 302.0403 |
|---|
| SMILES | O=C(CP(=O)(O)O)OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | DOTICUNVIZEPSN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupmonosaccharidecarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesacetalcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeoxaneprimary alcoholorganophosphonic acid derivativeorganoheterocyclic compound |
|---|
