| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:07 UTC |
|---|
| Update Date | 2025-03-25 00:47:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162694 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11F3N2O3 |
|---|
| Molecular Mass | 312.0722 |
|---|
| SMILES | O=C(CO)Nc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
|---|
| InChI Key | MQKVCHVEBAFIEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | diarylethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalcohols and polyolsalkyl fluoridesanilidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesn-arylamidesorganic oxidesorganofluoridesorganopnictogen compoundsphenol ethersphenoxy compoundspolyhalopyridinessecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundpolyhalopyridinen-arylamidecarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halide2-halopyridineorganoheterocyclic compoundalcoholazacyclealkyl fluorideorganofluorideheteroaromatic compoundhydroxypyridinecarboxamide groupanilidesecondary carboxylic acid amidepyridinehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
|---|