| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:09 UTC |
|---|
| Update Date | 2025-03-25 00:47:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162777 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H25NO3 |
|---|
| Molecular Mass | 303.1834 |
|---|
| SMILES | O=C(N1CCC(O)(c2ccccc2)CC1)C1(O)CCCCC1 |
|---|
| InChI Key | ILAKMSUSXROASH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativescyclic alcohols and derivativescyclohexanolshydrocarbon derivativesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundazacyclecyclohexanolcyclic alcoholcarboxamide groupcarboxylic acid derivativen-acyl-piperidinetertiary alcoholorganic oxideorganic oxygen compoundphenylpiperidinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|